About 2-benzylbenzenethiol
2-benzylbenzenethiol (PubChem CID 5255687) has the molecular formula C13H12S
and a molecular weight of 200.31 g/mol. Its IUPAC name is 2-benzylbenzenethiol.
Molecular Properties
| Compound Name | 2-benzylbenzenethiol |
| PubChem CID | 5255687 |
| Molecular Formula | C13H12S |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-benzylbenzenethiol |
| SMILES | Sc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C13H12S/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-9,14H,10H2 |
| InChIKey | QTKHXEAIGWJFPO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-benzylbenzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylbenzenethiol?
The IUPAC name of 2-benzylbenzenethiol (CID 5255687) is 2-benzylbenzenethiol.
What is the SMILES notation for 2-benzylbenzenethiol?
The canonical SMILES for 2-benzylbenzenethiol is Sc1ccccc1Cc1ccccc1.
What is the InChIKey of 2-benzylbenzenethiol?
The InChIKey is QTKHXEAIGWJFPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12S/c14-13-9-5-4-8-12(13)10-11-6-2-1-3-7-11/h1-9,14H,10H2.
What are the key properties of 2-benzylbenzenethiol?
2-benzylbenzenethiol has a molecular weight of 200.31 g/mol, XLogP of 3.57, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylbenzenethiol is sourced from PubChem (CID 5255687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).