C12H14N2S — CID 52557983
2-ethylsulfanyl-1-(3-methylphenyl)imidazole (PubChem CID 52557983) has the molecular formula C12H14N2S and a molecular weight of 218.32 g/mol. Its IUPAC name is 2-ethylsulfanyl-1-(3-methylphenyl)imidazole.
| Compound Name | 2-ethylsulfanyl-1-(3-methylphenyl)imidazole |
|---|---|
| PubChem CID | 52557983 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 2-ethylsulfanyl-1-(3-methylphenyl)imidazole |
| SMILES | CCSc1nccn1-c1cccc(C)c1 |
| InChI | InChI=1S/C12H14N2S/c1-3-15-12-13-7-8-14(12)11-6-4-5-10(2)9-11/h4-9H,3H2,1-2H3 |
| InChIKey | BUJZMNHWFMLBAG-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |