C21H34N2O3 — CID 52559669
2-ethoxy-N-[4-oxo-4-(2,4,4-trimethylpentan-2-ylamino)butyl]benzamide (PubChem CID 52559669) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-ethoxy-N-[4-oxo-4-(2,4,4-trimethylpentan-2-ylamino)butyl]benzamide.
| Compound Name | 2-ethoxy-N-[4-oxo-4-(2,4,4-trimethylpentan-2-ylamino)butyl]benzamide |
|---|---|
| PubChem CID | 52559669 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 2-ethoxy-N-[4-oxo-4-(2,4,4-trimethylpentan-2-ylamino)butyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NCCCC(=O)NC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C21H34N2O3/c1-7-26-17-12-9-8-11-16(17)19(25)22-14-10-13-18(24)23-21(5,6)15-20(2,3)4/h8-9,11-12H,7,10,13-15H2,1-6H3,(H,22,25)(H,23,24) |
| InChIKey | YXXQBEHKEOBZSY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|