C10H11F3O2 — CID 5256319
4,4,4-trifluoro-1-phenylbutane-1,3-diol (PubChem CID 5256319) has the molecular formula C10H11F3O2 and a molecular weight of 220.19 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-phenylbutane-1,3-diol.
| Compound Name | 4,4,4-trifluoro-1-phenylbutane-1,3-diol |
|---|---|
| PubChem CID | 5256319 |
| Molecular Formula | C10H11F3O2 |
| Molecular Weight | 220.19 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | 4,4,4-trifluoro-1-phenylbutane-1,3-diol |
| SMILES | OC(CC(O)C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C10H11F3O2/c11-10(12,13)9(15)6-8(14)7-4-2-1-3-5-7/h1-5,8-9,14-15H,6H2 |
| InChIKey | XWWKWKRVRQENAP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.19 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |