C22H19N3OS — CID 52564427
N-phenyl-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)-N-prop-2-enylacetamide (PubChem CID 52564427) has the molecular formula C22H19N3OS and a molecular weight of 373.48 g/mol. Its IUPAC name is N-phenyl-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)-N-prop-2-enylacetamide.
| Compound Name | N-phenyl-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 52564427 |
| Molecular Formula | C22H19N3OS |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-phenyl-2-(6-phenylimidazo[2,1-b][1,3]thiazol-3-yl)-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)Cc1csc2nc(-c3ccccc3)cn12)c1ccccc1 |
| InChI | InChI=1S/C22H19N3OS/c1-2-13-24(18-11-7-4-8-12-18)21(26)14-19-16-27-22-23-20(15-25(19)22)17-9-5-3-6-10-17/h2-12,15-16H,1,13-14H2 |
| InChIKey | ANOLQHLFJDRBSC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|