C16H16BrFN2O — CID 52565167
1-(4-bromo-2-methylphenyl)-3-[2-(4-fluorophenyl)ethyl]urea (PubChem CID 52565167) has the molecular formula C16H16BrFN2O and a molecular weight of 351.22 g/mol. Its IUPAC name is 1-(4-bromo-2-methylphenyl)-3-[2-(4-fluorophenyl)ethyl]urea.
| Compound Name | 1-(4-bromo-2-methylphenyl)-3-[2-(4-fluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 52565167 |
| Molecular Formula | C16H16BrFN2O |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 1-(4-bromo-2-methylphenyl)-3-[2-(4-fluorophenyl)ethyl]urea |
| SMILES | Cc1cc(Br)ccc1NC(=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C16H16BrFN2O/c1-11-10-13(17)4-7-15(11)20-16(21)19-9-8-12-2-5-14(18)6-3-12/h2-7,10H,8-9H2,1H3,(H2,19,20,21) |
| InChIKey | LGOKXDXMBGHZKG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |