About 4-(9H-pyrido[3,4-b]indol-1-yl)pyrimidin-2-amine
4-(9H-pyrido[3,4-b]indol-1-yl)pyrimidin-2-amine (PubChem CID 5257090) has the molecular formula C15H11N5
and a molecular weight of 261.29 g/mol. Its IUPAC name is 4-(9H-pyrido[3,4-b]indol-1-yl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(9H-pyrido[3,4-b]indol-1-yl)pyrimidin-2-amine |
| PubChem CID | 5257090 |
| Molecular Formula | C15H11N5 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 4-(9H-pyrido[3,4-b]indol-1-yl)pyrimidin-2-amine |
| SMILES | Nc1nccc(-c2nccc3c2[nH]c2ccccc23)n1 |
| InChI | InChI=1S/C15H11N5/c16-15-18-8-6-12(20-15)14-13-10(5-7-17-14)9-3-1-2-4-11(9)19-13/h1-8,19H,(H2,16,18,20) |
| InChIKey | IUDMZJRPDRCJEB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(9H-pyrido[3,4-b]indol-1-yl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(9H-pyrido[3,4-b]indol-1-yl)pyrimidin-2-amine?
The IUPAC name of 4-(9H-pyrido[3,4-b]indol-1-yl)pyrimidin-2-amine (CID 5257090) is 4-(9H-pyrido[3,4-b]indol-1-yl)pyrimidin-2-amine.
What is the SMILES notation for 4-(9H-pyrido[3,4-b]indol-1-yl)pyrimidin-2-amine?
The canonical SMILES for 4-(9H-pyrido[3,4-b]indol-1-yl)pyrimidin-2-amine is Nc1nccc(-c2nccc3c2[nH]c2ccccc23)n1.
What is the InChIKey of 4-(9H-pyrido[3,4-b]indol-1-yl)pyrimidin-2-amine?
The InChIKey is IUDMZJRPDRCJEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N5/c16-15-18-8-6-12(20-15)14-13-10(5-7-17-14)9-3-1-2-4-11(9)19-13/h1-8,19H,(H2,16,18,20).
What are the key properties of 4-(9H-pyrido[3,4-b]indol-1-yl)pyrimidin-2-amine?
4-(9H-pyrido[3,4-b]indol-1-yl)pyrimidin-2-amine has a molecular weight of 261.29 g/mol, XLogP of 2.76, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(9H-pyrido[3,4-b]indol-1-yl)pyrimidin-2-amine is sourced from PubChem (CID 5257090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).