About ethane-1,1,2,2-tetrathiol
ethane-1,1,2,2-tetrathiol (PubChem CID 5257129) has the molecular formula C2H6S4
and a molecular weight of 158.34 g/mol. Its IUPAC name is ethane-1,1,2,2-tetrathiol.
Molecular Properties
| Compound Name | ethane-1,1,2,2-tetrathiol |
| PubChem CID | 5257129 |
| Molecular Formula | C2H6S4 |
| Molecular Weight | 158.34 g/mol |
| Exact Mass | 157.94 |
| IUPAC Name | ethane-1,1,2,2-tetrathiol |
| SMILES | SC(S)C(S)S |
| InChI | InChI=1S/C2H6S4/c3-1(4)2(5)6/h1-6H |
| InChIKey | IXHOLQLYMHEFDO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,1,2,2-tetrathiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,1,2,2-tetrathiol?
The IUPAC name of ethane-1,1,2,2-tetrathiol (CID 5257129) is ethane-1,1,2,2-tetrathiol.
What is the SMILES notation for ethane-1,1,2,2-tetrathiol?
The canonical SMILES for ethane-1,1,2,2-tetrathiol is SC(S)C(S)S.
What is the InChIKey of ethane-1,1,2,2-tetrathiol?
The InChIKey is IXHOLQLYMHEFDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6S4/c3-1(4)2(5)6/h1-6H.
What are the key properties of ethane-1,1,2,2-tetrathiol?
ethane-1,1,2,2-tetrathiol has a molecular weight of 158.34 g/mol, XLogP of 1.36, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,1,2,2-tetrathiol is sourced from PubChem (CID 5257129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).