C10H15Cl3Si — CID 5257233
trichloro-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 5257233) has the molecular formula C10H15Cl3Si and a molecular weight of 269.67 g/mol. Its IUPAC name is trichloro-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | trichloro-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 5257233 |
| Molecular Formula | C10H15Cl3Si |
| Molecular Weight | 269.67 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | trichloro-(1,2,3,4,5-pentamethylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)([Si](Cl)(Cl)Cl)C(C)=C1C |
| InChI | InChI=1S/C10H15Cl3Si/c1-6-7(2)9(4)10(5,8(6)3)14(11,12)13/h1-5H3 |
| InChIKey | MYFUDIACVPBJLA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.67 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|