C16H7F13O3S — CID 5257306
6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)naphthalen-2-ol (PubChem CID 5257306) has the molecular formula C16H7F13O3S and a molecular weight of 526.27 g/mol. Its IUPAC name is 6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)naphthalen-2-ol.
| Compound Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)naphthalen-2-ol |
|---|---|
| PubChem CID | 5257306 |
| Molecular Formula | C16H7F13O3S |
| Molecular Weight | 526.27 g/mol |
| Exact Mass | 525.99 |
| IUPAC Name | 6-(1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluorohexylsulfonyl)naphthalen-2-ol |
| SMILES | O=S(=O)(c1ccc2cc(O)ccc2c1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H7F13O3S/c17-11(18,13(21,22)15(25,26)27)12(19,20)14(23,24)16(28,29)33(31,32)10-4-2-7-5-9(30)3-1-8(7)6-10/h1-6,30H |
| InChIKey | MPNYAHXZTBKNFK-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.27 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|