C17H25NO4 — CID 52574017
N-cyclopentyl-N-ethyl-2,4,5-trimethoxybenzamide (PubChem CID 52574017) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-cyclopentyl-N-ethyl-2,4,5-trimethoxybenzamide.
| Compound Name | N-cyclopentyl-N-ethyl-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 52574017 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | N-cyclopentyl-N-ethyl-2,4,5-trimethoxybenzamide |
| SMILES | CCN(C(=O)c1cc(OC)c(OC)cc1OC)C1CCCC1 |
| InChI | InChI=1S/C17H25NO4/c1-5-18(12-8-6-7-9-12)17(19)13-10-15(21-3)16(22-4)11-14(13)20-2/h10-12H,5-9H2,1-4H3 |
| InChIKey | FDXUCTKEHLFHAI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |