C16H24BrNO2S — CID 52574191
2-(4-bromo-2-methylphenyl)sulfanyl-N-(2-methoxyethyl)-N-(2-methylpropyl)acetamide (PubChem CID 52574191) has the molecular formula C16H24BrNO2S and a molecular weight of 374.34 g/mol. Its IUPAC name is 2-(4-bromo-2-methylphenyl)sulfanyl-N-(2-methoxyethyl)-N-(2-methylpropyl)acetamide.
| Compound Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-(2-methoxyethyl)-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 52574191 |
| Molecular Formula | C16H24BrNO2S |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 2-(4-bromo-2-methylphenyl)sulfanyl-N-(2-methoxyethyl)-N-(2-methylpropyl)acetamide |
| SMILES | COCCN(CC(C)C)C(=O)CSc1ccc(Br)cc1C |
| InChI | InChI=1S/C16H24BrNO2S/c1-12(2)10-18(7-8-20-4)16(19)11-21-15-6-5-14(17)9-13(15)3/h5-6,9,12H,7-8,10-11H2,1-4H3 |
| InChIKey | KDBKKPHCINYRMR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |