About dihexoxy(dimethyl)silane
dihexoxy(dimethyl)silane (PubChem CID 525745) has the molecular formula C14H32O2Si
and a molecular weight of 260.49 g/mol. Its IUPAC name is dihexoxy(dimethyl)silane.
Molecular Properties
| Compound Name | dihexoxy(dimethyl)silane |
| PubChem CID | 525745 |
| Molecular Formula | C14H32O2Si |
| Molecular Weight | 260.49 g/mol |
| Exact Mass | 260.22 |
| IUPAC Name | dihexoxy(dimethyl)silane |
| SMILES | CCCCCCO[Si](C)(C)OCCCCCC |
| InChI | InChI=1S/C14H32O2Si/c1-5-7-9-11-13-15-17(3,4)16-14-12-10-8-6-2/h5-14H2,1-4H3 |
| InChIKey | AIBXROJFINODCQ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dihexoxy(dimethyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihexoxy(dimethyl)silane?
The IUPAC name of dihexoxy(dimethyl)silane (CID 525745) is dihexoxy(dimethyl)silane.
What is the SMILES notation for dihexoxy(dimethyl)silane?
The canonical SMILES for dihexoxy(dimethyl)silane is CCCCCCO[Si](C)(C)OCCCCCC.
What is the InChIKey of dihexoxy(dimethyl)silane?
The InChIKey is AIBXROJFINODCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H32O2Si/c1-5-7-9-11-13-15-17(3,4)16-14-12-10-8-6-2/h5-14H2,1-4H3.
What are the key properties of dihexoxy(dimethyl)silane?
dihexoxy(dimethyl)silane has a molecular weight of 260.49 g/mol, XLogP of 4.88, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dihexoxy(dimethyl)silane is sourced from PubChem (CID 525745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).