About 4,7-dioxatetracyclo[4.3.0.02,9.03,5]nonan-8-one
4,7-dioxatetracyclo[4.3.0.02,9.03,5]nonan-8-one (PubChem CID 5257478) has the molecular formula C7H6O3
and a molecular weight of 138.12 g/mol. Its IUPAC name is 4,7-dioxatetracyclo[4.3.0.02,9.03,5]nonan-8-one.
Molecular Properties
| Compound Name | 4,7-dioxatetracyclo[4.3.0.02,9.03,5]nonan-8-one |
| PubChem CID | 5257478 |
| Molecular Formula | C7H6O3 |
| Molecular Weight | 138.12 g/mol |
| Exact Mass | 138.03 |
| IUPAC Name | 4,7-dioxatetracyclo[4.3.0.02,9.03,5]nonan-8-one |
| SMILES | O=C1OC2C3OC3C3C1C23 |
| InChI | InChI=1S/C7H6O3/c8-7-3-1-2(3)5(10-7)6-4(1)9-6/h1-6H |
| InChIKey | RMGFOXPNSBDOOF-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.12 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dioxatetracyclo[4.3.0.02,9.03,5]nonan-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dioxatetracyclo[4.3.0.02,9.03,5]nonan-8-one?
The IUPAC name of 4,7-dioxatetracyclo[4.3.0.02,9.03,5]nonan-8-one (CID 5257478) is 4,7-dioxatetracyclo[4.3.0.02,9.03,5]nonan-8-one.
What is the SMILES notation for 4,7-dioxatetracyclo[4.3.0.02,9.03,5]nonan-8-one?
The canonical SMILES for 4,7-dioxatetracyclo[4.3.0.02,9.03,5]nonan-8-one is O=C1OC2C3OC3C3C1C23.
What is the InChIKey of 4,7-dioxatetracyclo[4.3.0.02,9.03,5]nonan-8-one?
The InChIKey is RMGFOXPNSBDOOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3/c8-7-3-1-2(3)5(10-7)6-4(1)9-6/h1-6H.
What are the key properties of 4,7-dioxatetracyclo[4.3.0.02,9.03,5]nonan-8-one?
4,7-dioxatetracyclo[4.3.0.02,9.03,5]nonan-8-one has a molecular weight of 138.12 g/mol, XLogP of -0.44, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dioxatetracyclo[4.3.0.02,9.03,5]nonan-8-one is sourced from PubChem (CID 5257478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).