About azuleno[1,2-b]thiophene
azuleno[1,2-b]thiophene (PubChem CID 5257479) has the molecular formula C12H8S
and a molecular weight of 184.26 g/mol. Its IUPAC name is azuleno[1,2-b]thiophene.
Molecular Properties
| Compound Name | azuleno[1,2-b]thiophene |
| PubChem CID | 5257479 |
| Molecular Formula | C12H8S |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.03 |
| IUPAC Name | azuleno[1,2-b]thiophene |
| SMILES | c1ccc2cc3ccsc3c-2cc1 |
| InChI | InChI=1S/C12H8S/c1-2-4-9-8-10-6-7-13-12(10)11(9)5-3-1/h1-8H |
| InChIKey | AYTCEVSTYDFOLI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azuleno[1,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azuleno[1,2-b]thiophene?
The IUPAC name of azuleno[1,2-b]thiophene (CID 5257479) is azuleno[1,2-b]thiophene.
What is the SMILES notation for azuleno[1,2-b]thiophene?
The canonical SMILES for azuleno[1,2-b]thiophene is c1ccc2cc3ccsc3c-2cc1.
What is the InChIKey of azuleno[1,2-b]thiophene?
The InChIKey is AYTCEVSTYDFOLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8S/c1-2-4-9-8-10-6-7-13-12(10)11(9)5-3-1/h1-8H.
What are the key properties of azuleno[1,2-b]thiophene?
azuleno[1,2-b]thiophene has a molecular weight of 184.26 g/mol, XLogP of 4.01, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azuleno[1,2-b]thiophene is sourced from PubChem (CID 5257479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).