About triheptoxy(methyl)silane
triheptoxy(methyl)silane (PubChem CID 525768) has the molecular formula C22H48O3Si
and a molecular weight of 388.71 g/mol. Its IUPAC name is triheptoxy(methyl)silane.
Molecular Properties
| Compound Name | triheptoxy(methyl)silane |
| PubChem CID | 525768 |
| Molecular Formula | C22H48O3Si |
| Molecular Weight | 388.71 g/mol |
| Exact Mass | 388.34 |
| IUPAC Name | triheptoxy(methyl)silane |
| SMILES | CCCCCCCO[Si](C)(OCCCCCCC)OCCCCCCC |
| InChI | InChI=1S/C22H48O3Si/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3/h5-22H2,1-4H3 |
| InChIKey | ANIZCGCAILJFJL-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.71 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze triheptoxy(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of triheptoxy(methyl)silane?
The IUPAC name of triheptoxy(methyl)silane (CID 525768) is triheptoxy(methyl)silane.
What is the SMILES notation for triheptoxy(methyl)silane?
The canonical SMILES for triheptoxy(methyl)silane is CCCCCCCO[Si](C)(OCCCCCCC)OCCCCCCC.
What is the InChIKey of triheptoxy(methyl)silane?
The InChIKey is ANIZCGCAILJFJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H48O3Si/c1-5-8-11-14-17-20-23-26(4,24-21-18-15-12-9-6-2)25-22-19-16-13-10-7-3/h5-22H2,1-4H3.
What are the key properties of triheptoxy(methyl)silane?
triheptoxy(methyl)silane has a molecular weight of 388.71 g/mol, XLogP of 7.52, 21 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for triheptoxy(methyl)silane is sourced from PubChem (CID 525768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).