About 6'-(benzenesulfonyl)-8'-methyl-6'-propylspiro[1,3-dioxolane-2,2'-8-azabicyclo[3.2.1]octane]
6'-(benzenesulfonyl)-8'-methyl-6'-propylspiro[1,3-dioxolane-2,2'-8-azabicyclo[3.2.1]octane] (PubChem CID 5257705) has the molecular formula C19H27NO4S
and a molecular weight of 365.50 g/mol. Its IUPAC name is 6'-(benzenesulfonyl)-8'-methyl-6'-propylspiro[1,3-dioxolane-2,2'-8-azabicyclo[3.2.1]octane].
Molecular Properties
| Compound Name | 6'-(benzenesulfonyl)-8'-methyl-6'-propylspiro[1,3-dioxolane-2,2'-8-azabicyclo[3.2.1]octane] |
| PubChem CID | 5257705 |
| Molecular Formula | C19H27NO4S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 6'-(benzenesulfonyl)-8'-methyl-6'-propylspiro[1,3-dioxolane-2,2'-8-azabicyclo[3.2.1]octane] |
| SMILES | CCCC1(S(=O)(=O)c2ccccc2)CC2N(C)C1CCC21OCCO1 |
| InChI | InChI=1S/C19H27NO4S/c1-3-10-18(25(21,22)15-7-5-4-6-8-15)14-17-19(23-12-13-24-19)11-9-16(18)20(17)2/h4-8,16-17H,3,9-14H2,1-2H3 |
| InChIKey | ZWSPZVBJFUJPAT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6'-(benzenesulfonyl)-8'-methyl-6'-propylspiro[1,3-dioxolane-2,2'-8-azabicyclo[3.2.1]octane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6'-(benzenesulfonyl)-8'-methyl-6'-propylspiro[1,3-dioxolane-2,2'-8-azabicyclo[3.2.1]octane]?
The IUPAC name of 6'-(benzenesulfonyl)-8'-methyl-6'-propylspiro[1,3-dioxolane-2,2'-8-azabicyclo[3.2.1]octane] (CID 5257705) is 6'-(benzenesulfonyl)-8'-methyl-6'-propylspiro[1,3-dioxolane-2,2'-8-azabicyclo[3.2.1]octane].
What is the SMILES notation for 6'-(benzenesulfonyl)-8'-methyl-6'-propylspiro[1,3-dioxolane-2,2'-8-azabicyclo[3.2.1]octane]?
The canonical SMILES for 6'-(benzenesulfonyl)-8'-methyl-6'-propylspiro[1,3-dioxolane-2,2'-8-azabicyclo[3.2.1]octane] is CCCC1(S(=O)(=O)c2ccccc2)CC2N(C)C1CCC21OCCO1.
What is the InChIKey of 6'-(benzenesulfonyl)-8'-methyl-6'-propylspiro[1,3-dioxolane-2,2'-8-azabicyclo[3.2.1]octane]?
The InChIKey is ZWSPZVBJFUJPAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H27NO4S/c1-3-10-18(25(21,22)15-7-5-4-6-8-15)14-17-19(23-12-13-24-19)11-9-16(18)20(17)2/h4-8,16-17H,3,9-14H2,1-2H3.
What are the key properties of 6'-(benzenesulfonyl)-8'-methyl-6'-propylspiro[1,3-dioxolane-2,2'-8-azabicyclo[3.2.1]octane]?
6'-(benzenesulfonyl)-8'-methyl-6'-propylspiro[1,3-dioxolane-2,2'-8-azabicyclo[3.2.1]octane] has a molecular weight of 365.50 g/mol, XLogP of 2.61, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6'-(benzenesulfonyl)-8'-methyl-6'-propylspiro[1,3-dioxolane-2,2'-8-azabicyclo[3.2.1]octane] is sourced from PubChem (CID 5257705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).