C7H8N2S4 — CID 5257760
3,4,6λ4,8-tetrathia-5,7-diazatricyclo[8.2.1.02,9]trideca-5,6,11-triene (PubChem CID 5257760) has the molecular formula C7H8N2S4 and a molecular weight of 248.42 g/mol. Its IUPAC name is 3,4,6λ4,8-tetrathia-5,7-diazatricyclo[8.2.1.02,9]trideca-5,6,11-triene.
| Compound Name | 3,4,6λ4,8-tetrathia-5,7-diazatricyclo[8.2.1.02,9]trideca-5,6,11-triene |
|---|---|
| PubChem CID | 5257760 |
| Molecular Formula | C7H8N2S4 |
| Molecular Weight | 248.42 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 3,4,6λ4,8-tetrathia-5,7-diazatricyclo[8.2.1.02,9]trideca-5,6,11-triene |
| SMILES | C1=CC2CC1C1SN=S=NSSC21 |
| InChI | InChI=1S/C7H8N2S4/c1-2-5-3-4(1)6-7(5)11-13-9-12-8-10-6/h1-2,4-7H,3H2 |
| InChIKey | AZQBFBWXRSCLJL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|