About N'-decyl-N,N-dimethylpropanimidamide
N'-decyl-N,N-dimethylpropanimidamide (PubChem CID 525839) has the molecular formula C15H32N2
and a molecular weight of 240.43 g/mol. Its IUPAC name is N'-decyl-N,N-dimethylpropanimidamide.
Molecular Properties
| Compound Name | N'-decyl-N,N-dimethylpropanimidamide |
| PubChem CID | 525839 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | N'-decyl-N,N-dimethylpropanimidamide |
| SMILES | CCCCCCCCCC/N=C(\CC)N(C)C |
| InChI | InChI=1S/C15H32N2/c1-5-7-8-9-10-11-12-13-14-16-15(6-2)17(3)4/h5-14H2,1-4H3/b16-15+ |
| InChIKey | TWWHORUVBIISQU-FOCLMDBBSA-N |
| XLogP | 4.50 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-decyl-N,N-dimethylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-decyl-N,N-dimethylpropanimidamide?
The IUPAC name of N'-decyl-N,N-dimethylpropanimidamide (CID 525839) is N'-decyl-N,N-dimethylpropanimidamide.
What is the SMILES notation for N'-decyl-N,N-dimethylpropanimidamide?
The canonical SMILES for N'-decyl-N,N-dimethylpropanimidamide is CCCCCCCCCC/N=C(\CC)N(C)C.
What is the InChIKey of N'-decyl-N,N-dimethylpropanimidamide?
The InChIKey is TWWHORUVBIISQU-FOCLMDBBSA-N. The full InChI is InChI=1S/C15H32N2/c1-5-7-8-9-10-11-12-13-14-16-15(6-2)17(3)4/h5-14H2,1-4H3/b16-15+.
What are the key properties of N'-decyl-N,N-dimethylpropanimidamide?
N'-decyl-N,N-dimethylpropanimidamide has a molecular weight of 240.43 g/mol, XLogP of 4.50, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-decyl-N,N-dimethylpropanimidamide is sourced from PubChem (CID 525839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).