About N,N-dimethyl-N'-nonylpropanimidamide
N,N-dimethyl-N'-nonylpropanimidamide (PubChem CID 525842) has the molecular formula C14H30N2
and a molecular weight of 226.41 g/mol. Its IUPAC name is N,N-dimethyl-N'-nonylpropanimidamide.
Molecular Properties
| Compound Name | N,N-dimethyl-N'-nonylpropanimidamide |
| PubChem CID | 525842 |
| Molecular Formula | C14H30N2 |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 226.24 |
| IUPAC Name | N,N-dimethyl-N'-nonylpropanimidamide |
| SMILES | CCCCCCCCC/N=C(\CC)N(C)C |
| InChI | InChI=1S/C14H30N2/c1-5-7-8-9-10-11-12-13-15-14(6-2)16(3)4/h5-13H2,1-4H3/b15-14+ |
| InChIKey | KOVLPGYCOAGVEZ-CCEZHUSRSA-N |
| XLogP | 4.11 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethyl-N'-nonylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-N'-nonylpropanimidamide?
The IUPAC name of N,N-dimethyl-N'-nonylpropanimidamide (CID 525842) is N,N-dimethyl-N'-nonylpropanimidamide.
What is the SMILES notation for N,N-dimethyl-N'-nonylpropanimidamide?
The canonical SMILES for N,N-dimethyl-N'-nonylpropanimidamide is CCCCCCCCC/N=C(\CC)N(C)C.
What is the InChIKey of N,N-dimethyl-N'-nonylpropanimidamide?
The InChIKey is KOVLPGYCOAGVEZ-CCEZHUSRSA-N. The full InChI is InChI=1S/C14H30N2/c1-5-7-8-9-10-11-12-13-15-14(6-2)16(3)4/h5-13H2,1-4H3/b15-14+.
What are the key properties of N,N-dimethyl-N'-nonylpropanimidamide?
N,N-dimethyl-N'-nonylpropanimidamide has a molecular weight of 226.41 g/mol, XLogP of 4.11, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-N'-nonylpropanimidamide is sourced from PubChem (CID 525842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).