About [(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] methanesulfonate
[(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] methanesulfonate (PubChem CID 5258660) has the molecular formula C8H9NO4S
and a molecular weight of 215.23 g/mol. Its IUPAC name is [(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] methanesulfonate.
Molecular Properties
| Compound Name | [(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] methanesulfonate |
| PubChem CID | 5258660 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | [(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] methanesulfonate |
| SMILES | CC1=CC(=NOS(C)(=O)=O)C=CC1=O |
| InChI | InChI=1S/C8H9NO4S/c1-6-5-7(3-4-8(6)10)9-13-14(2,11)12/h3-5H,1-2H3 |
| InChIKey | JVHQWNBLSMIEDQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] methanesulfonate?
The IUPAC name of [(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] methanesulfonate (CID 5258660) is [(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] methanesulfonate.
What is the SMILES notation for [(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] methanesulfonate?
The canonical SMILES for [(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] methanesulfonate is CC1=CC(=NOS(C)(=O)=O)C=CC1=O.
What is the InChIKey of [(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] methanesulfonate?
The InChIKey is JVHQWNBLSMIEDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4S/c1-6-5-7(3-4-8(6)10)9-13-14(2,11)12/h3-5H,1-2H3.
What are the key properties of [(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] methanesulfonate?
[(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] methanesulfonate has a molecular weight of 215.23 g/mol, XLogP of 0.40, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3-methyl-4-oxocyclohexa-2,5-dien-1-ylidene)amino] methanesulfonate is sourced from PubChem (CID 5258660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).