About N'-hexyl-N,N,2,2-tetramethylpropanimidamide
N'-hexyl-N,N,2,2-tetramethylpropanimidamide (PubChem CID 525905) has the molecular formula C13H28N2
and a molecular weight of 212.38 g/mol. Its IUPAC name is N'-hexyl-N,N,2,2-tetramethylpropanimidamide.
Molecular Properties
| Compound Name | N'-hexyl-N,N,2,2-tetramethylpropanimidamide |
| PubChem CID | 525905 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | N'-hexyl-N,N,2,2-tetramethylpropanimidamide |
| SMILES | CCCCCC/N=C(\N(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H28N2/c1-7-8-9-10-11-14-12(15(5)6)13(2,3)4/h7-11H2,1-6H3/b14-12- |
| InChIKey | SRHWRWHIGQGKIB-OWBHPGMISA-N |
| XLogP | 3.57 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-hexyl-N,N,2,2-tetramethylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hexyl-N,N,2,2-tetramethylpropanimidamide?
The IUPAC name of N'-hexyl-N,N,2,2-tetramethylpropanimidamide (CID 525905) is N'-hexyl-N,N,2,2-tetramethylpropanimidamide.
What is the SMILES notation for N'-hexyl-N,N,2,2-tetramethylpropanimidamide?
The canonical SMILES for N'-hexyl-N,N,2,2-tetramethylpropanimidamide is CCCCCC/N=C(\N(C)C)C(C)(C)C.
What is the InChIKey of N'-hexyl-N,N,2,2-tetramethylpropanimidamide?
The InChIKey is SRHWRWHIGQGKIB-OWBHPGMISA-N. The full InChI is InChI=1S/C13H28N2/c1-7-8-9-10-11-14-12(15(5)6)13(2,3)4/h7-11H2,1-6H3/b14-12-.
What are the key properties of N'-hexyl-N,N,2,2-tetramethylpropanimidamide?
N'-hexyl-N,N,2,2-tetramethylpropanimidamide has a molecular weight of 212.38 g/mol, XLogP of 3.57, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hexyl-N,N,2,2-tetramethylpropanimidamide is sourced from PubChem (CID 525905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).