About N,N,2-trimethyl-N'-nonylpropanimidamide
N,N,2-trimethyl-N'-nonylpropanimidamide (PubChem CID 525906) has the molecular formula C15H32N2
and a molecular weight of 240.43 g/mol. Its IUPAC name is N,N,2-trimethyl-N'-nonylpropanimidamide.
Molecular Properties
| Compound Name | N,N,2-trimethyl-N'-nonylpropanimidamide |
| PubChem CID | 525906 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | N,N,2-trimethyl-N'-nonylpropanimidamide |
| SMILES | CCCCCCCCC/N=C(\C(C)C)N(C)C |
| InChI | InChI=1S/C15H32N2/c1-6-7-8-9-10-11-12-13-16-15(14(2)3)17(4)5/h14H,6-13H2,1-5H3/b16-15+ |
| InChIKey | RZFZHKKCFUQDES-FOCLMDBBSA-N |
| XLogP | 4.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N,2-trimethyl-N'-nonylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,2-trimethyl-N'-nonylpropanimidamide?
The IUPAC name of N,N,2-trimethyl-N'-nonylpropanimidamide (CID 525906) is N,N,2-trimethyl-N'-nonylpropanimidamide.
What is the SMILES notation for N,N,2-trimethyl-N'-nonylpropanimidamide?
The canonical SMILES for N,N,2-trimethyl-N'-nonylpropanimidamide is CCCCCCCCC/N=C(\C(C)C)N(C)C.
What is the InChIKey of N,N,2-trimethyl-N'-nonylpropanimidamide?
The InChIKey is RZFZHKKCFUQDES-FOCLMDBBSA-N. The full InChI is InChI=1S/C15H32N2/c1-6-7-8-9-10-11-12-13-16-15(14(2)3)17(4)5/h14H,6-13H2,1-5H3/b16-15+.
What are the key properties of N,N,2-trimethyl-N'-nonylpropanimidamide?
N,N,2-trimethyl-N'-nonylpropanimidamide has a molecular weight of 240.43 g/mol, XLogP of 4.35, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,2-trimethyl-N'-nonylpropanimidamide is sourced from PubChem (CID 525906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).