About N,N,2,2-tetramethyl-N'-pentylpropanimidamide
N,N,2,2-tetramethyl-N'-pentylpropanimidamide (PubChem CID 525911) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is N,N,2,2-tetramethyl-N'-pentylpropanimidamide.
Molecular Properties
| Compound Name | N,N,2,2-tetramethyl-N'-pentylpropanimidamide |
| PubChem CID | 525911 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | N,N,2,2-tetramethyl-N'-pentylpropanimidamide |
| SMILES | CCCCC/N=C(\N(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H26N2/c1-7-8-9-10-13-11(14(5)6)12(2,3)4/h7-10H2,1-6H3/b13-11- |
| InChIKey | VORTZOUBEQWEEQ-QBFSEMIESA-N |
| XLogP | 3.18 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N,N,2,2-tetramethyl-N'-pentylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N,2,2-tetramethyl-N'-pentylpropanimidamide?
The IUPAC name of N,N,2,2-tetramethyl-N'-pentylpropanimidamide (CID 525911) is N,N,2,2-tetramethyl-N'-pentylpropanimidamide.
What is the SMILES notation for N,N,2,2-tetramethyl-N'-pentylpropanimidamide?
The canonical SMILES for N,N,2,2-tetramethyl-N'-pentylpropanimidamide is CCCCC/N=C(\N(C)C)C(C)(C)C.
What is the InChIKey of N,N,2,2-tetramethyl-N'-pentylpropanimidamide?
The InChIKey is VORTZOUBEQWEEQ-QBFSEMIESA-N. The full InChI is InChI=1S/C12H26N2/c1-7-8-9-10-13-11(14(5)6)12(2,3)4/h7-10H2,1-6H3/b13-11-.
What are the key properties of N,N,2,2-tetramethyl-N'-pentylpropanimidamide?
N,N,2,2-tetramethyl-N'-pentylpropanimidamide has a molecular weight of 198.35 g/mol, XLogP of 3.18, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N,2,2-tetramethyl-N'-pentylpropanimidamide is sourced from PubChem (CID 525911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).