About 1,5,7-triaza-3-azoniatricyclo[3.3.1.13,7]decane
1,5,7-triaza-3-azoniatricyclo[3.3.1.13,7]decane (PubChem CID 5259712) has the molecular formula C6H13N4+
and a molecular weight of 141.20 g/mol. Its IUPAC name is 1,5,7-triaza-3-azoniatricyclo[3.3.1.13,7]decane.
Molecular Properties
| Compound Name | 1,5,7-triaza-3-azoniatricyclo[3.3.1.13,7]decane |
| PubChem CID | 5259712 |
| Molecular Formula | C6H13N4+ |
| Molecular Weight | 141.20 g/mol |
| Exact Mass | 141.11 |
| IUPAC Name | 1,5,7-triaza-3-azoniatricyclo[3.3.1.13,7]decane |
| SMILES | C1N2CN3CN1C[NH+](C2)C3 |
| InChI | InChI=1S/C6H12N4/c1-7-2-9-4-8(1)5-10(3-7)6-9/h1-6H2/p+1 |
| InChIKey | VKYKSIONXSXAKP-UHFFFAOYSA-O |
| XLogP | -2.44 |
| TPSA | 14.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.20 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5,7-triaza-3-azoniatricyclo[3.3.1.13,7]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5,7-triaza-3-azoniatricyclo[3.3.1.13,7]decane?
The IUPAC name of 1,5,7-triaza-3-azoniatricyclo[3.3.1.13,7]decane (CID 5259712) is 1,5,7-triaza-3-azoniatricyclo[3.3.1.13,7]decane.
What is the SMILES notation for 1,5,7-triaza-3-azoniatricyclo[3.3.1.13,7]decane?
The canonical SMILES for 1,5,7-triaza-3-azoniatricyclo[3.3.1.13,7]decane is C1N2CN3CN1C[NH+](C2)C3.
What is the InChIKey of 1,5,7-triaza-3-azoniatricyclo[3.3.1.13,7]decane?
The InChIKey is VKYKSIONXSXAKP-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H12N4/c1-7-2-9-4-8(1)5-10(3-7)6-9/h1-6H2/p+1.
What are the key properties of 1,5,7-triaza-3-azoniatricyclo[3.3.1.13,7]decane?
1,5,7-triaza-3-azoniatricyclo[3.3.1.13,7]decane has a molecular weight of 141.20 g/mol, XLogP of -2.44, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5,7-triaza-3-azoniatricyclo[3.3.1.13,7]decane is sourced from PubChem (CID 5259712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).