About (4-tert-butylphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate
(4-tert-butylphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate (PubChem CID 52600378) has the molecular formula C17H25NO4S
and a molecular weight of 339.46 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate.
Molecular Properties
| Compound Name | (4-tert-butylphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate |
| PubChem CID | 52600378 |
| Molecular Formula | C17H25NO4S |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | (4-tert-butylphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate |
| SMILES | CC(C)(C)c1ccc(COC(=O)CN2CCS(=O)(=O)CC2)cc1 |
| InChI | InChI=1S/C17H25NO4S/c1-17(2,3)15-6-4-14(5-7-15)13-22-16(19)12-18-8-10-23(20,21)11-9-18/h4-7H,8-13H2,1-3H3 |
| InChIKey | ADKKCRQCQQAWLY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-tert-butylphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate?
The IUPAC name of (4-tert-butylphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate (CID 52600378) is (4-tert-butylphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate.
What is the SMILES notation for (4-tert-butylphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate?
The canonical SMILES for (4-tert-butylphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate is CC(C)(C)c1ccc(COC(=O)CN2CCS(=O)(=O)CC2)cc1.
What is the InChIKey of (4-tert-butylphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate?
The InChIKey is ADKKCRQCQQAWLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO4S/c1-17(2,3)15-6-4-14(5-7-15)13-22-16(19)12-18-8-10-23(20,21)11-9-18/h4-7H,8-13H2,1-3H3.
What are the key properties of (4-tert-butylphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate?
(4-tert-butylphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate has a molecular weight of 339.46 g/mol, XLogP of 1.76, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylphenyl)methyl 2-(1,1-dioxo-1,4-thiazinan-4-yl)acetate is sourced from PubChem (CID 52600378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).