C27H39F6NO4Si3 — CID 526012
N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-N-methyl-3,5-bis(trifluoromethyl)benzamide (PubChem CID 526012) has the molecular formula C27H39F6NO4Si3 and a molecular weight of 639.86 g/mol. Its IUPAC name is N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-N-methyl-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-N-methyl-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 526012 |
| Molecular Formula | C27H39F6NO4Si3 |
| Molecular Weight | 639.86 g/mol |
| Exact Mass | 639.21 |
| IUPAC Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]-2-trimethylsilyloxyethyl]-N-methyl-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CN(CC(O[Si](C)(C)C)c1ccc(O[Si](C)(C)C)c(O[Si](C)(C)C)c1)C(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H39F6NO4Si3/c1-34(25(35)19-13-20(26(28,29)30)16-21(14-19)27(31,32)33)17-24(38-41(8,9)10)18-11-12-22(36-39(2,3)4)23(15-18)37-40(5,6)7/h11-16,24H,17H2,1-10H3 |
| InChIKey | PGCARAXUUGXVRZ-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.86 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|