About dimethyl anthracene-1,8-dicarboxylate
dimethyl anthracene-1,8-dicarboxylate (PubChem CID 5260121) has the molecular formula C18H14O4
and a molecular weight of 294.31 g/mol. Its IUPAC name is dimethyl anthracene-1,8-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl anthracene-1,8-dicarboxylate |
| PubChem CID | 5260121 |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | dimethyl anthracene-1,8-dicarboxylate |
| SMILES | COC(=O)c1cccc2cc3cccc(C(=O)OC)c3cc12 |
| InChI | InChI=1S/C18H14O4/c1-21-17(19)13-7-3-5-11-9-12-6-4-8-14(18(20)22-2)16(12)10-15(11)13/h3-10H,1-2H3 |
| InChIKey | ALYSIEHCBBJETD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl anthracene-1,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl anthracene-1,8-dicarboxylate?
The IUPAC name of dimethyl anthracene-1,8-dicarboxylate (CID 5260121) is dimethyl anthracene-1,8-dicarboxylate.
What is the SMILES notation for dimethyl anthracene-1,8-dicarboxylate?
The canonical SMILES for dimethyl anthracene-1,8-dicarboxylate is COC(=O)c1cccc2cc3cccc(C(=O)OC)c3cc12.
What is the InChIKey of dimethyl anthracene-1,8-dicarboxylate?
The InChIKey is ALYSIEHCBBJETD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O4/c1-21-17(19)13-7-3-5-11-9-12-6-4-8-14(18(20)22-2)16(12)10-15(11)13/h3-10H,1-2H3.
What are the key properties of dimethyl anthracene-1,8-dicarboxylate?
dimethyl anthracene-1,8-dicarboxylate has a molecular weight of 294.31 g/mol, XLogP of 3.57, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl anthracene-1,8-dicarboxylate is sourced from PubChem (CID 5260121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).