C23H29F6NO3Si2 — CID 526013
N-[2-[3,4-bis(trimethylsilyloxy)phenyl]ethyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 526013) has the molecular formula C23H29F6NO3Si2 and a molecular weight of 537.65 g/mol. Its IUPAC name is N-[2-[3,4-bis(trimethylsilyloxy)phenyl]ethyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]ethyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 526013 |
| Molecular Formula | C23H29F6NO3Si2 |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | N-[2-[3,4-bis(trimethylsilyloxy)phenyl]ethyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | C[Si](C)(C)Oc1ccc(CCNC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1O[Si](C)(C)C |
| InChI | InChI=1S/C23H29F6NO3Si2/c1-34(2,3)32-19-8-7-15(11-20(19)33-35(4,5)6)9-10-30-21(31)16-12-17(22(24,25)26)14-18(13-16)23(27,28)29/h7-8,11-14H,9-10H2,1-6H3,(H,30,31) |
| InChIKey | PYXIZYRTPJQVIZ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|