About 4,5-bis(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol
4,5-bis(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol (PubChem CID 5260256) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 4,5-bis(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol.
Molecular Properties
| Compound Name | 4,5-bis(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol |
| PubChem CID | 5260256 |
| Molecular Formula | C8H13NO3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.09 |
| IUPAC Name | 4,5-bis(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol |
| SMILES | CC1NC=C(CO)C(CO)=C1O |
| InChI | InChI=1S/C8H13NO3/c1-5-8(12)7(4-11)6(3-10)2-9-5/h2,5,9-12H,3-4H2,1H3 |
| InChIKey | JGPDPKBUPKVADS-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,5-bis(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol?
The IUPAC name of 4,5-bis(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol (CID 5260256) is 4,5-bis(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol.
What is the SMILES notation for 4,5-bis(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol?
The canonical SMILES for 4,5-bis(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol is CC1NC=C(CO)C(CO)=C1O.
What is the InChIKey of 4,5-bis(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol?
The InChIKey is JGPDPKBUPKVADS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-5-8(12)7(4-11)6(3-10)2-9-5/h2,5,9-12H,3-4H2,1H3.
What are the key properties of 4,5-bis(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol?
4,5-bis(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol has a molecular weight of 171.20 g/mol, XLogP of -0.34, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(hydroxymethyl)-2-methyl-1,2-dihydropyridin-3-ol is sourced from PubChem (CID 5260256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).