C28H54O3Si3 — CID 526026
[10,13-dimethyl-3,7-bis(trimethylsilyloxy)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane (PubChem CID 526026) has the molecular formula C28H54O3Si3 and a molecular weight of 523.00 g/mol. Its IUPAC name is [10,13-dimethyl-3,7-bis(trimethylsilyloxy)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane.
| Compound Name | [10,13-dimethyl-3,7-bis(trimethylsilyloxy)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 526026 |
| Molecular Formula | C28H54O3Si3 |
| Molecular Weight | 523.00 g/mol |
| Exact Mass | 522.34 |
| IUPAC Name | [10,13-dimethyl-3,7-bis(trimethylsilyloxy)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxy-trimethylsilane |
| SMILES | CC12CCC(O[Si](C)(C)C)CC1=CC(O[Si](C)(C)C)C1C2CCC2(C)C(O[Si](C)(C)C)CCC12 |
| InChI | InChI=1S/C28H54O3Si3/c1-27-16-14-21(29-32(3,4)5)18-20(27)19-24(30-33(6,7)8)26-22-12-13-25(31-34(9,10)11)28(22,2)17-15-23(26)27/h19,21-26H,12-18H2,1-11H3 |
| InChIKey | YZJWSRYSQHTCFY-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.00 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|