C16H18N2O — CID 5260280
7,7-dimethyl-3-phenyl-1,4,6,8-tetrahydrocinnolin-5-one (PubChem CID 5260280) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 7,7-dimethyl-3-phenyl-1,4,6,8-tetrahydrocinnolin-5-one.
| Compound Name | 7,7-dimethyl-3-phenyl-1,4,6,8-tetrahydrocinnolin-5-one |
|---|---|
| PubChem CID | 5260280 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 7,7-dimethyl-3-phenyl-1,4,6,8-tetrahydrocinnolin-5-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)NN=C(c1ccccc1)C2 |
| InChI | InChI=1S/C16H18N2O/c1-16(2)9-14-12(15(19)10-16)8-13(17-18-14)11-6-4-3-5-7-11/h3-7,18H,8-10H2,1-2H3 |
| InChIKey | REBKRPZPHKECSJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |