About tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one
tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one (PubChem CID 5260406) has the molecular formula C13H14O
and a molecular weight of 186.25 g/mol. Its IUPAC name is tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one.
Molecular Properties
| Compound Name | tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one |
| PubChem CID | 5260406 |
| Molecular Formula | C13H14O |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one |
| SMILES | O=C1C2CCC1Cc1ccccc1C2 |
| InChI | InChI=1S/C13H14O/c14-13-11-5-6-12(13)8-10-4-2-1-3-9(10)7-11/h1-4,11-12H,5-8H2 |
| InChIKey | CMCAOQYLMULHEZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one?
The IUPAC name of tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one (CID 5260406) is tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one.
What is the SMILES notation for tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one?
The canonical SMILES for tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one is O=C1C2CCC1Cc1ccccc1C2.
What is the InChIKey of tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one?
The InChIKey is CMCAOQYLMULHEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O/c14-13-11-5-6-12(13)8-10-4-2-1-3-9(10)7-11/h1-4,11-12H,5-8H2.
What are the key properties of tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one?
tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one has a molecular weight of 186.25 g/mol, XLogP of 2.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[8.2.1.03,8]trideca-3,5,7-trien-13-one is sourced from PubChem (CID 5260406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).