About [4-acetyloxy-4-(methoxymethyl)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl] acetate
[4-acetyloxy-4-(methoxymethyl)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl] acetate (PubChem CID 5260448) has the molecular formula C16H20O6
and a molecular weight of 308.33 g/mol. Its IUPAC name is [4-acetyloxy-4-(methoxymethyl)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl] acetate.
Molecular Properties
| Compound Name | [4-acetyloxy-4-(methoxymethyl)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl] acetate |
| PubChem CID | 5260448 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [4-acetyloxy-4-(methoxymethyl)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl] acetate |
| SMILES | COCC1(OC(C)=O)C(=O)C2C3C=CC(C3)C2C1OC(C)=O |
| InChI | InChI=1S/C16H20O6/c1-8(17)21-15-13-11-5-4-10(6-11)12(13)14(19)16(15,7-20-3)22-9(2)18/h4-5,10-13,15H,6-7H2,1-3H3 |
| InChIKey | HMIBKKISLZEADF-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [4-acetyloxy-4-(methoxymethyl)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-acetyloxy-4-(methoxymethyl)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl] acetate?
The IUPAC name of [4-acetyloxy-4-(methoxymethyl)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl] acetate (CID 5260448) is [4-acetyloxy-4-(methoxymethyl)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl] acetate.
What is the SMILES notation for [4-acetyloxy-4-(methoxymethyl)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl] acetate?
The canonical SMILES for [4-acetyloxy-4-(methoxymethyl)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl] acetate is COCC1(OC(C)=O)C(=O)C2C3C=CC(C3)C2C1OC(C)=O.
What is the InChIKey of [4-acetyloxy-4-(methoxymethyl)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl] acetate?
The InChIKey is HMIBKKISLZEADF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O6/c1-8(17)21-15-13-11-5-4-10(6-11)12(13)14(19)16(15,7-20-3)22-9(2)18/h4-5,10-13,15H,6-7H2,1-3H3.
What are the key properties of [4-acetyloxy-4-(methoxymethyl)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl] acetate?
[4-acetyloxy-4-(methoxymethyl)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl] acetate has a molecular weight of 308.33 g/mol, XLogP of 0.89, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-acetyloxy-4-(methoxymethyl)-5-oxo-3-tricyclo[5.2.1.02,6]dec-8-enyl] acetate is sourced from PubChem (CID 5260448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).