About 11-fluoro-5,6-dihydrobenzo[c]acridine
11-fluoro-5,6-dihydrobenzo[c]acridine (PubChem CID 5260555) has the molecular formula C17H12FN
and a molecular weight of 249.29 g/mol. Its IUPAC name is 11-fluoro-5,6-dihydrobenzo[c]acridine.
Molecular Properties
| Compound Name | 11-fluoro-5,6-dihydrobenzo[c]acridine |
| PubChem CID | 5260555 |
| Molecular Formula | C17H12FN |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 11-fluoro-5,6-dihydrobenzo[c]acridine |
| SMILES | Fc1cccc2cc3c(nc12)-c1ccccc1CC3 |
| InChI | InChI=1S/C17H12FN/c18-15-7-3-5-12-10-13-9-8-11-4-1-2-6-14(11)16(13)19-17(12)15/h1-7,10H,8-9H2 |
| InChIKey | VVKJZJCNFLHOPS-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 11-fluoro-5,6-dihydrobenzo[c]acridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-fluoro-5,6-dihydrobenzo[c]acridine?
The IUPAC name of 11-fluoro-5,6-dihydrobenzo[c]acridine (CID 5260555) is 11-fluoro-5,6-dihydrobenzo[c]acridine.
What is the SMILES notation for 11-fluoro-5,6-dihydrobenzo[c]acridine?
The canonical SMILES for 11-fluoro-5,6-dihydrobenzo[c]acridine is Fc1cccc2cc3c(nc12)-c1ccccc1CC3.
What is the InChIKey of 11-fluoro-5,6-dihydrobenzo[c]acridine?
The InChIKey is VVKJZJCNFLHOPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12FN/c18-15-7-3-5-12-10-13-9-8-11-4-1-2-6-14(11)16(13)19-17(12)15/h1-7,10H,8-9H2.
What are the key properties of 11-fluoro-5,6-dihydrobenzo[c]acridine?
11-fluoro-5,6-dihydrobenzo[c]acridine has a molecular weight of 249.29 g/mol, XLogP of 4.14, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-fluoro-5,6-dihydrobenzo[c]acridine is sourced from PubChem (CID 5260555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).