C11H13N3O3 — CID 5260586
4-(3,4-dimethoxyphenyl)-3-methyl-1H-1,2,4-triazol-5-one (PubChem CID 5260586) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-3-methyl-1H-1,2,4-triazol-5-one.
| Compound Name | 4-(3,4-dimethoxyphenyl)-3-methyl-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 5260586 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-3-methyl-1H-1,2,4-triazol-5-one |
| SMILES | COc1ccc(-n2c(C)n[nH]c2=O)cc1OC |
| InChI | InChI=1S/C11H13N3O3/c1-7-12-13-11(15)14(7)8-4-5-9(16-2)10(6-8)17-3/h4-6H,1-3H3,(H,13,15) |
| InChIKey | INVSRAALTRUHNT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |