About 2-ethyl-1H-imidazole-4,5-dicarbonitrile
2-ethyl-1H-imidazole-4,5-dicarbonitrile (PubChem CID 5260593) has the molecular formula C7H6N4
and a molecular weight of 146.15 g/mol. Its IUPAC name is 2-ethyl-1H-imidazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-ethyl-1H-imidazole-4,5-dicarbonitrile |
| PubChem CID | 5260593 |
| Molecular Formula | C7H6N4 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 2-ethyl-1H-imidazole-4,5-dicarbonitrile |
| SMILES | CCc1nc(C#N)c(C#N)[nH]1 |
| InChI | InChI=1S/C7H6N4/c1-2-7-10-5(3-8)6(4-9)11-7/h2H2,1H3,(H,10,11) |
| InChIKey | JBGUQPNUGTYMCR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 76.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-1H-imidazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1H-imidazole-4,5-dicarbonitrile?
The IUPAC name of 2-ethyl-1H-imidazole-4,5-dicarbonitrile (CID 5260593) is 2-ethyl-1H-imidazole-4,5-dicarbonitrile.
What is the SMILES notation for 2-ethyl-1H-imidazole-4,5-dicarbonitrile?
The canonical SMILES for 2-ethyl-1H-imidazole-4,5-dicarbonitrile is CCc1nc(C#N)c(C#N)[nH]1.
What is the InChIKey of 2-ethyl-1H-imidazole-4,5-dicarbonitrile?
The InChIKey is JBGUQPNUGTYMCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4/c1-2-7-10-5(3-8)6(4-9)11-7/h2H2,1H3,(H,10,11).
What are the key properties of 2-ethyl-1H-imidazole-4,5-dicarbonitrile?
2-ethyl-1H-imidazole-4,5-dicarbonitrile has a molecular weight of 146.15 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1H-imidazole-4,5-dicarbonitrile is sourced from PubChem (CID 5260593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).