About 1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine
1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine (PubChem CID 5260656) has the molecular formula C10H12ClN3
and a molecular weight of 209.68 g/mol. Its IUPAC name is 1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine |
| PubChem CID | 5260656 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cnc2ccc(Cl)cn12 |
| InChI | InChI=1S/C10H12ClN3/c1-13(2)7-9-5-12-10-4-3-8(11)6-14(9)10/h3-6H,7H2,1-2H3 |
| InChIKey | ZIRURUMISQLJOU-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine (CID 5260656) is 1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine is CN(C)Cc1cnc2ccc(Cl)cn12.
What is the InChIKey of 1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine?
The InChIKey is ZIRURUMISQLJOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN3/c1-13(2)7-9-5-12-10-4-3-8(11)6-14(9)10/h3-6H,7H2,1-2H3.
What are the key properties of 1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine?
1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine has a molecular weight of 209.68 g/mol, XLogP of 2.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chloroimidazo[1,2-a]pyridin-3-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 5260656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).