About trimethylsilyl 10-methyldodecanoate
trimethylsilyl 10-methyldodecanoate (PubChem CID 526083) has the molecular formula C16H34O2Si
and a molecular weight of 286.53 g/mol. Its IUPAC name is trimethylsilyl 10-methyldodecanoate.
Molecular Properties
| Compound Name | trimethylsilyl 10-methyldodecanoate |
| PubChem CID | 526083 |
| Molecular Formula | C16H34O2Si |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.23 |
| IUPAC Name | trimethylsilyl 10-methyldodecanoate |
| SMILES | CCC(C)CCCCCCCCC(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C16H34O2Si/c1-6-15(2)13-11-9-7-8-10-12-14-16(17)18-19(3,4)5/h15H,6-14H2,1-5H3 |
| InChIKey | IHHDEEVODWBADL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethylsilyl 10-methyldodecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethylsilyl 10-methyldodecanoate?
The IUPAC name of trimethylsilyl 10-methyldodecanoate (CID 526083) is trimethylsilyl 10-methyldodecanoate.
What is the SMILES notation for trimethylsilyl 10-methyldodecanoate?
The canonical SMILES for trimethylsilyl 10-methyldodecanoate is CCC(C)CCCCCCCCC(=O)O[Si](C)(C)C.
What is the InChIKey of trimethylsilyl 10-methyldodecanoate?
The InChIKey is IHHDEEVODWBADL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O2Si/c1-6-15(2)13-11-9-7-8-10-12-14-16(17)18-19(3,4)5/h15H,6-14H2,1-5H3.
What are the key properties of trimethylsilyl 10-methyldodecanoate?
trimethylsilyl 10-methyldodecanoate has a molecular weight of 286.53 g/mol, XLogP of 5.53, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trimethylsilyl 10-methyldodecanoate is sourced from PubChem (CID 526083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).