About methyl 5-acetyloxyhexanoate
methyl 5-acetyloxyhexanoate (PubChem CID 526152) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is methyl 5-acetyloxyhexanoate.
Molecular Properties
| Compound Name | methyl 5-acetyloxyhexanoate |
| PubChem CID | 526152 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | methyl 5-acetyloxyhexanoate |
| SMILES | COC(=O)CCCC(C)OC(C)=O |
| InChI | InChI=1S/C9H16O4/c1-7(13-8(2)10)5-4-6-9(11)12-3/h7H,4-6H2,1-3H3 |
| InChIKey | XZGQJRXRXRYNRI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-acetyloxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-acetyloxyhexanoate?
The IUPAC name of methyl 5-acetyloxyhexanoate (CID 526152) is methyl 5-acetyloxyhexanoate.
What is the SMILES notation for methyl 5-acetyloxyhexanoate?
The canonical SMILES for methyl 5-acetyloxyhexanoate is COC(=O)CCCC(C)OC(C)=O.
What is the InChIKey of methyl 5-acetyloxyhexanoate?
The InChIKey is XZGQJRXRXRYNRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4/c1-7(13-8(2)10)5-4-6-9(11)12-3/h7H,4-6H2,1-3H3.
What are the key properties of methyl 5-acetyloxyhexanoate?
methyl 5-acetyloxyhexanoate has a molecular weight of 188.22 g/mol, XLogP of 1.28, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-acetyloxyhexanoate is sourced from PubChem (CID 526152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).