About dibutyl (4-methylphenyl) phosphate
dibutyl (4-methylphenyl) phosphate (PubChem CID 526162) has the molecular formula C15H25O4P
and a molecular weight of 300.33 g/mol. Its IUPAC name is dibutyl (4-methylphenyl) phosphate.
Molecular Properties
| Compound Name | dibutyl (4-methylphenyl) phosphate |
| PubChem CID | 526162 |
| Molecular Formula | C15H25O4P |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | dibutyl (4-methylphenyl) phosphate |
| SMILES | CCCCOP(=O)(OCCCC)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C15H25O4P/c1-4-6-12-17-20(16,18-13-7-5-2)19-15-10-8-14(3)9-11-15/h8-11H,4-7,12-13H2,1-3H3 |
| InChIKey | AXVQGNPTHCNQLJ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dibutyl (4-methylphenyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl (4-methylphenyl) phosphate?
The IUPAC name of dibutyl (4-methylphenyl) phosphate (CID 526162) is dibutyl (4-methylphenyl) phosphate.
What is the SMILES notation for dibutyl (4-methylphenyl) phosphate?
The canonical SMILES for dibutyl (4-methylphenyl) phosphate is CCCCOP(=O)(OCCCC)Oc1ccc(C)cc1.
What is the InChIKey of dibutyl (4-methylphenyl) phosphate?
The InChIKey is AXVQGNPTHCNQLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25O4P/c1-4-6-12-17-20(16,18-13-7-5-2)19-15-10-8-14(3)9-11-15/h8-11H,4-7,12-13H2,1-3H3.
What are the key properties of dibutyl (4-methylphenyl) phosphate?
dibutyl (4-methylphenyl) phosphate has a molecular weight of 300.33 g/mol, XLogP of 5.12, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl (4-methylphenyl) phosphate is sourced from PubChem (CID 526162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).