About 2-thiophen-2-ylfuran
2-thiophen-2-ylfuran (PubChem CID 526176) has the molecular formula C8H6OS
and a molecular weight of 150.20 g/mol. Its IUPAC name is 2-thiophen-2-ylfuran.
Molecular Properties
| Compound Name | 2-thiophen-2-ylfuran |
| PubChem CID | 526176 |
| Molecular Formula | C8H6OS |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.01 |
| IUPAC Name | 2-thiophen-2-ylfuran |
| SMILES | c1coc(-c2cccs2)c1 |
| InChI | InChI=1S/C8H6OS/c1-3-7(9-5-1)8-4-2-6-10-8/h1-6H |
| InChIKey | RVYKTPRETIBSPK-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-thiophen-2-ylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-ylfuran?
The IUPAC name of 2-thiophen-2-ylfuran (CID 526176) is 2-thiophen-2-ylfuran.
What is the SMILES notation for 2-thiophen-2-ylfuran?
The canonical SMILES for 2-thiophen-2-ylfuran is c1coc(-c2cccs2)c1.
What is the InChIKey of 2-thiophen-2-ylfuran?
The InChIKey is RVYKTPRETIBSPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6OS/c1-3-7(9-5-1)8-4-2-6-10-8/h1-6H.
What are the key properties of 2-thiophen-2-ylfuran?
2-thiophen-2-ylfuran has a molecular weight of 150.20 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-ylfuran is sourced from PubChem (CID 526176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).