C24H38O2Si2 — CID 526216
trimethyl-[(13-methyl-3-trimethylsilyloxy-1,6,7,8,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl)oxy]silane (PubChem CID 526216) has the molecular formula C24H38O2Si2 and a molecular weight of 414.74 g/mol. Its IUPAC name is trimethyl-[(13-methyl-3-trimethylsilyloxy-1,6,7,8,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl)oxy]silane.
| Compound Name | trimethyl-[(13-methyl-3-trimethylsilyloxy-1,6,7,8,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl)oxy]silane |
|---|---|
| PubChem CID | 526216 |
| Molecular Formula | C24H38O2Si2 |
| Molecular Weight | 414.74 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | trimethyl-[(13-methyl-3-trimethylsilyloxy-1,6,7,8,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl)oxy]silane |
| SMILES | CC12C=CC3=C4CC=C(O[Si](C)(C)C)C=C4CCC3C1CCC2O[Si](C)(C)C |
| InChI | InChI=1S/C24H38O2Si2/c1-24-15-14-20-19-11-9-18(25-27(2,3)4)16-17(19)8-10-21(20)22(24)12-13-23(24)26-28(5,6)7/h9,14-16,21-23H,8,10-13H2,1-7H3 |
| InChIKey | PJBUVIMQXWOOFQ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.74 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|