C12H3Br5O — CID 526238
1,2,4,6,7-pentabromodibenzofuran (PubChem CID 526238) has the molecular formula C12H3Br5O and a molecular weight of 562.68 g/mol. Its IUPAC name is 1,2,4,6,7-pentabromodibenzofuran.
| Compound Name | 1,2,4,6,7-pentabromodibenzofuran |
|---|---|
| PubChem CID | 526238 |
| Molecular Formula | C12H3Br5O |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 557.61 |
| IUPAC Name | 1,2,4,6,7-pentabromodibenzofuran |
| SMILES | Brc1ccc2c(oc3c(Br)cc(Br)c(Br)c32)c1Br |
| InChI | InChI=1S/C12H3Br5O/c13-5-2-1-4-8-9(16)6(14)3-7(15)12(8)18-11(4)10(5)17/h1-3H |
| InChIKey | FYCPIPVDIYQOBA-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|