C17H17NO2S — CID 5262680
N-phenacyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 5262680) has the molecular formula C17H17NO2S and a molecular weight of 299.39 g/mol. Its IUPAC name is N-phenacyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-phenacyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 5262680 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N-phenacyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | O=C(CNC(=O)c1csc2c1CCCC2)c1ccccc1 |
| InChI | InChI=1S/C17H17NO2S/c19-15(12-6-2-1-3-7-12)10-18-17(20)14-11-21-16-9-5-4-8-13(14)16/h1-3,6-7,11H,4-5,8-10H2,(H,18,20) |
| InChIKey | CFMJQYGCOIJPGM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |