About 1,4,6,9-tetrabromodibenzofuran
1,4,6,9-tetrabromodibenzofuran (PubChem CID 526291) has the molecular formula C12H4Br4O
and a molecular weight of 483.78 g/mol. Its IUPAC name is 1,4,6,9-tetrabromodibenzofuran.
Molecular Properties
| Compound Name | 1,4,6,9-tetrabromodibenzofuran |
| PubChem CID | 526291 |
| Molecular Formula | C12H4Br4O |
| Molecular Weight | 483.78 g/mol |
| Exact Mass | 479.70 |
| IUPAC Name | 1,4,6,9-tetrabromodibenzofuran |
| SMILES | Brc1ccc(Br)c2c1oc1c(Br)ccc(Br)c12 |
| InChI | InChI=1S/C12H4Br4O/c13-5-1-3-7(15)11-9(5)10-6(14)2-4-8(16)12(10)17-11/h1-4H |
| InChIKey | GWVVZHZSUINYIC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 483.78 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,4,6,9-tetrabromodibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4,6,9-tetrabromodibenzofuran?
The IUPAC name of 1,4,6,9-tetrabromodibenzofuran (CID 526291) is 1,4,6,9-tetrabromodibenzofuran.
What is the SMILES notation for 1,4,6,9-tetrabromodibenzofuran?
The canonical SMILES for 1,4,6,9-tetrabromodibenzofuran is Brc1ccc(Br)c2c1oc1c(Br)ccc(Br)c12.
What is the InChIKey of 1,4,6,9-tetrabromodibenzofuran?
The InChIKey is GWVVZHZSUINYIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H4Br4O/c13-5-1-3-7(15)11-9(5)10-6(14)2-4-8(16)12(10)17-11/h1-4H.
What are the key properties of 1,4,6,9-tetrabromodibenzofuran?
1,4,6,9-tetrabromodibenzofuran has a molecular weight of 483.78 g/mol, XLogP of 6.64, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4,6,9-tetrabromodibenzofuran is sourced from PubChem (CID 526291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).