C12H2Br6O — CID 526307
2,3,4,6,7,8-hexabromodibenzofuran (PubChem CID 526307) has the molecular formula C12H2Br6O and a molecular weight of 641.57 g/mol. Its IUPAC name is 2,3,4,6,7,8-hexabromodibenzofuran.
| Compound Name | 2,3,4,6,7,8-hexabromodibenzofuran |
|---|---|
| PubChem CID | 526307 |
| Molecular Formula | C12H2Br6O |
| Molecular Weight | 641.57 g/mol |
| Exact Mass | 635.52 |
| IUPAC Name | 2,3,4,6,7,8-hexabromodibenzofuran |
| SMILES | Brc1cc2c(oc3c(Br)c(Br)c(Br)cc32)c(Br)c1Br |
| InChI | InChI=1S/C12H2Br6O/c13-5-1-3-4-2-6(14)8(16)10(18)12(4)19-11(3)9(17)7(5)15/h1-2H |
| InChIKey | GKJPDCOZDNSVRH-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.57 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|