About 5-chloro-4-[(3,4-dichlorophenyl)methylsulfonylmethyl]-3-methyl-1-phenylpyrazole
5-chloro-4-[(3,4-dichlorophenyl)methylsulfonylmethyl]-3-methyl-1-phenylpyrazole (PubChem CID 52635080) has the molecular formula C18H15Cl3N2O2S
and a molecular weight of 429.76 g/mol. Its IUPAC name is 5-chloro-4-[(3,4-dichlorophenyl)methylsulfonylmethyl]-3-methyl-1-phenylpyrazole.
Molecular Properties
| Compound Name | 5-chloro-4-[(3,4-dichlorophenyl)methylsulfonylmethyl]-3-methyl-1-phenylpyrazole |
| PubChem CID | 52635080 |
| Molecular Formula | C18H15Cl3N2O2S |
| Molecular Weight | 429.76 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | 5-chloro-4-[(3,4-dichlorophenyl)methylsulfonylmethyl]-3-methyl-1-phenylpyrazole |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H15Cl3N2O2S/c1-12-15(18(21)23(22-12)14-5-3-2-4-6-14)11-26(24,25)10-13-7-8-16(19)17(20)9-13/h2-9H,10-11H2,1H3 |
| InChIKey | FFCXHRDEYKSSLT-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.76 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-4-[(3,4-dichlorophenyl)methylsulfonylmethyl]-3-methyl-1-phenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-[(3,4-dichlorophenyl)methylsulfonylmethyl]-3-methyl-1-phenylpyrazole?
The IUPAC name of 5-chloro-4-[(3,4-dichlorophenyl)methylsulfonylmethyl]-3-methyl-1-phenylpyrazole (CID 52635080) is 5-chloro-4-[(3,4-dichlorophenyl)methylsulfonylmethyl]-3-methyl-1-phenylpyrazole.
What is the SMILES notation for 5-chloro-4-[(3,4-dichlorophenyl)methylsulfonylmethyl]-3-methyl-1-phenylpyrazole?
The canonical SMILES for 5-chloro-4-[(3,4-dichlorophenyl)methylsulfonylmethyl]-3-methyl-1-phenylpyrazole is Cc1nn(-c2ccccc2)c(Cl)c1CS(=O)(=O)Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 5-chloro-4-[(3,4-dichlorophenyl)methylsulfonylmethyl]-3-methyl-1-phenylpyrazole?
The InChIKey is FFCXHRDEYKSSLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15Cl3N2O2S/c1-12-15(18(21)23(22-12)14-5-3-2-4-6-14)11-26(24,25)10-13-7-8-16(19)17(20)9-13/h2-9H,10-11H2,1H3.
What are the key properties of 5-chloro-4-[(3,4-dichlorophenyl)methylsulfonylmethyl]-3-methyl-1-phenylpyrazole?
5-chloro-4-[(3,4-dichlorophenyl)methylsulfonylmethyl]-3-methyl-1-phenylpyrazole has a molecular weight of 429.76 g/mol, XLogP of 5.26, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-[(3,4-dichlorophenyl)methylsulfonylmethyl]-3-methyl-1-phenylpyrazole is sourced from PubChem (CID 52635080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).