C13H23N3OS — CID 52635167
5-ethyl-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfanyl]-1H-1,2,4-triazole (PubChem CID 52635167) has the molecular formula C13H23N3OS and a molecular weight of 269.41 g/mol. Its IUPAC name is 5-ethyl-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfanyl]-1H-1,2,4-triazole.
| Compound Name | 5-ethyl-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfanyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 52635167 |
| Molecular Formula | C13H23N3OS |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 5-ethyl-3-[2-[(1S,2R)-2-methylcyclohexyl]oxyethylsulfanyl]-1H-1,2,4-triazole |
| SMILES | CCc1nc(SCCO[C@H]2CCCC[C@H]2C)n[nH]1 |
| InChI | InChI=1S/C13H23N3OS/c1-3-12-14-13(16-15-12)18-9-8-17-11-7-5-4-6-10(11)2/h10-11H,3-9H2,1-2H3,(H,14,15,16)/t10-,11+/m1/s1 |
| InChIKey | HJBMPOSKCOHSHM-MNOVXSKESA-N |
| XLogP | 3.05 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|