C23H29NO4 — CID 5263615
2-oxo-7-propoxy-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)chromene-3-carboxamide (PubChem CID 5263615) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is 2-oxo-7-propoxy-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)chromene-3-carboxamide.
| Compound Name | 2-oxo-7-propoxy-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 5263615 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | 2-oxo-7-propoxy-N-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)chromene-3-carboxamide |
| SMILES | CCCOc1ccc2cc(C(=O)NC3CC4CCC3(C)C4(C)C)c(=O)oc2c1 |
| InChI | InChI=1S/C23H29NO4/c1-5-10-27-16-7-6-14-11-17(21(26)28-18(14)13-16)20(25)24-19-12-15-8-9-23(19,4)22(15,2)3/h6-7,11,13,15,19H,5,8-10,12H2,1-4H3,(H,24,25) |
| InChIKey | VKXKOOJMZNZINW-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|